CAS 2137065-16-6 appears in our catalog under these names: cis–2–(4–bromophenyl)cyclopropane–1–carboxylic acid, (1R,2S)-2-(4-Bromophenyl)cyclopropanecarboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
Cis-(1R,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid (CAS 2137065-16-6) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: cis-(1R,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: DPBUJVBXRABXRH-RKDXNWHRSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | cis-(1R,2S)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | DPBUJVBXRABXRH-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)