CAS 6142-65-0 appears in our catalog under these names: Trans-2-(4-bromophenyl)cyclopropanecarboxylic acid, 95%, Trans–2–(4–bromophenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid, trans, rel-(1R,2R)-2-(4-Bromophenyl)cyclopropanecarboxylic acid, 98%, 98%, TRANS-2-(4-BROMOPHENYL)CYCLOPROPANECARBOXYLIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Trans-(1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid (CAS 6142-65-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: DPBUJVBXRABXRH-DTWKUNHWSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | DPBUJVBXRABXRH-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)