CAS 24133-85-5 is the registry number for 2,4-Dichloro-1-methyl-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,4-dichloro-1-methylbenzimidazole (CAS 24133-85-5) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2,4-dichloro-1-methylbenzimidazole. InChIKey: IGGOTTIRBWKAOR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2,4-dichloro-1-methylbenzimidazole |
| InChIKey | IGGOTTIRBWKAOR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)Cl)N=C1Cl |
Computed by PubChem (NCBI)