CAS 24149-57-3 is the registry number for 6-Aminoquinoline-5,8-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-aminoquinoline-5,8-dione (CAS 24149-57-3) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 6-aminoquinoline-5,8-dione. InChIKey: ZNVLEAPAWPQEIC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 6-aminoquinoline-5,8-dione |
| InChIKey | ZNVLEAPAWPQEIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C=C(C2=O)N)N=C1 |
Computed by PubChem (NCBI)