CAS 24364-02-1 appears in our catalog under these names: 3-(4-Amino-3-nitrophenyl)acrylic acid, 95+%, 3-(4-amino-3-nitrophenyl)acrylic acid, 3-(4-Amino-3-nitrophenyl)acrylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
(E)-3-(4-amino-3-nitrophenyl)prop-2-enoic acid (CAS 24364-02-1) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: (E)-3-(4-amino-3-nitrophenyl)prop-2-enoic acid. InChIKey: HCVYCRFCWROKQK-DUXPYHPUSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | (E)-3-(4-amino-3-nitrophenyl)prop-2-enoic acid |
| InChIKey | HCVYCRFCWROKQK-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)