CAS 2451906-45-7 is the registry number for Methyl 6-bromo-2,4-difluoro-3-methylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-bromo-2,4-difluoro-3-methylbenzoate (CAS 2451906-45-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 6-bromo-2,4-difluoro-3-methylbenzoate. InChIKey: IXRHZIGMKOQYEN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 6-bromo-2,4-difluoro-3-methylbenzoate |
| InChIKey | IXRHZIGMKOQYEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Br)C(=O)OC)F |
Computed by PubChem (NCBI)