Products 2459946-53-1
CAS 2459946-53-1 is the registry number for Taltobulin intermediate-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl (E,4R)-2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride (CAS 2459946-53-1) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: ethyl (E,4R)-2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride. InChIKey: DOGUQADNNOKYBX-VDOXMPJBSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | ethyl (E,4R)-2,5-dimethyl-4-(methylamino)hex-2-enoate;hydrochloride |
| InChIKey | DOGUQADNNOKYBX-VDOXMPJBSA-N |
| SMILES | CCOC(=O)/C(=C/[C@@H](C(C)C)NC)/C.Cl |
Computed by PubChem (NCBI)