Products 2462-35-3
CAS 2462-35-3 appears in our catalog under these names: Benzyl L–leucinate hydrochloride, (S)-Benzyl 2-amino-4-methylpentanoate hydrochloride, H-Leu-OBzl·HCl 97%, (S)-Benzyl 2-amino-4-methylpentanoate hydrochloride, 97%, 97%, (S)-Benzyl 2-amino-4-methylpentanoate hydrochloride, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 250mg, 1g, 5g, 10g, 500g.
Benzyl (2S)-2-amino-4-methylpentanoate;hydrochloride (CAS 2462-35-3) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: benzyl (2S)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: HCYLOEGSAOVRIT-YDALLXLXSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | benzyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | HCYLOEGSAOVRIT-YDALLXLXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
benzyl (2S)-2-amino-4-methylpentanoate hydrochloride, (S)-Benzyl 2-amino-4-methylpentanoate hydrochloride, L-Leucine benzyl ester hydrochloride, Benzyl L-leucinate hydrochloride, L-Leucine benzyl ester HCl, benzyl (2S)-2-amino-4-methylpentanoate;hydrochloride, [(2S)-4-methyl-1-oxo-1-phenylmethoxypentan-2-yl]azanium;chloride, H-Leu-OBzl.HCl, H-Leu-OBzl inverted exclamation mark currencyHCl, (S)-Benzyl2-amino-4-methylpentanoatehydrochloride