Products 68838-94-8
CAS 68838-94-8 appears in our catalog under these names: H-D-Leu-OBzl·HCl 98%, (R)-Benzyl 2-aMino-4-Methylpentanoate hydrochloride, 98%, 98%, Benzyl D-leucinate hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
Benzyl (2R)-2-amino-4-methylpentanoate;hydrochloride (CAS 68838-94-8) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: benzyl (2R)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: HCYLOEGSAOVRIT-UTONKHPSSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | benzyl (2R)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | HCYLOEGSAOVRIT-UTONKHPSSA-N |
| SMILES | CC(C)C[C@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-Benzyl 2-amino-4-methylpentanoate hydrochloride, benzyl D-leucinate hydrochloride, Benzyl (R)-2-Amino-4-methylpentanoate Hydrochloride, D-Leu-Obzl.Hcl, (R)-Benzyl2-amino-4-methylpentanoatehydrochloride, (R)-Benzyl 2-amino-4-methylpentanoate HCl, Benzyl D-leucinate--hydrogen chloride (1/1), benzyl (2R)-2-amino-4-methyl-pentanoate;hydrochloride, benzyl (2R)-2-amino-4-methylpentanoate;hydrochloride