Products 2483831-52-1
CAS 2483831-52-1 is the registry number for L-Lysine-d9 (dihydrochloride). Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2S)-2,6-diamino-2,3,3,4,4,5,5,6,6-nonadeuteriohexanoic acid;dihydrochloride (CAS 2483831-52-1) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 228.16 g/mol. IUPAC name: (2S)-2,6-diamino-2,3,3,4,4,5,5,6,6-nonadeuteriohexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-SFOBNDERSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 228.16 g/mol |
| IUPAC name | (2S)-2,6-diamino-2,3,3,4,4,5,5,6,6-nonadeuteriohexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-SFOBNDERSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N)N.Cl.Cl |
Computed by PubChem (NCBI)