CAS 24953-77-3 is the registry number for 7-Hydroxy-5-methoxy-1,3-dihydro-2-benzofuran-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-hydroxy-5-methoxy-3H-2-benzofuran-1-one (CAS 24953-77-3) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 7-hydroxy-5-methoxy-3H-2-benzofuran-1-one. InChIKey: DQVAVEZQPWBKEW-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 7-hydroxy-5-methoxy-3H-2-benzofuran-1-one |
| InChIKey | DQVAVEZQPWBKEW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)O)C(=O)OC2 |
Computed by PubChem (NCBI)