CAS 2497-38-3 appears in our catalog under these names: (E)-4-((4-Hydroxyphenyl)diazenyl)benzoic acid, 95%, 4'-Hydroxyazobenzene-4-carboxylic Acid, >98.0%(HPLC)(T), (E)-4-((4-Hydroxyphenyl)diazenyl)benzoic acid, ≥97%, 4-[(4-Hydroxyphenyl)azo]benzoic acid, 96%, 4-((4-Hydroxyphenyl)diazenyl)benzoic acid, 97%. Offered by: Combi-blocks, TCI, Fluorochem, Chemat, BLDpharm. Available pack sizes: 200mg, 250mg, 1g, 5g, 100mg.
4-[(4-hydroxyphenyl)diazenyl]benzoic acid (CAS 2497-38-3) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)diazenyl]benzoic acid. InChIKey: HLVCZTOFOWHIJZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)diazenyl]benzoic acid |
| InChIKey | HLVCZTOFOWHIJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)