CAS 2503-06-2 appears in our catalog under these names: Dienogest Impurity 6, Estra-5(10),9(11)-diene-3,17-dione, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
(8S,13S,14S)-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (CAS 2503-06-2) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: (8S,13S,14S)-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione. InChIKey: REHQUZZHQLORLC-RYRKJORJSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (8S,13S,14S)-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | REHQUZZHQLORLC-RYRKJORJSA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CCC2=O)CCC4=C3CCC(=O)C4 |
Computed by PubChem (NCBI)