CAS 2503205-12-5 is the registry number for 2-(3,4,5-Trifluorophenyl)propan-2-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride (CAS 2503205-12-5) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride. InChIKey: BDUBJQHMTQTTRB-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | BDUBJQHMTQTTRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C(=C1)F)F)F)N.Cl |
Computed by PubChem (NCBI)