Products 2504147-70-8

CAS 2504147-70-8 is the registry number for Trans 3-(4-amino-cyclohexyl)-acrylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(E)-3-(4-aminocyclohexyl)prop-2-enoic acid;hydrochloride (CAS 2504147-70-8) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: (E)-3-(4-aminocyclohexyl)prop-2-enoic acid;hydrochloride. InChIKey: RFDRAOVYQRQKJQ-ZIKNSQGESA-N.

Identity
Molecular formulaC9H16ClNO2
Molecular weight205.68 g/mol
IUPAC name(E)-3-(4-aminocyclohexyl)prop-2-enoic acid;hydrochloride
InChIKeyRFDRAOVYQRQKJQ-ZIKNSQGESA-N
SMILESC1CC(CCC1/C=C/C(=O)O)N.Cl

Computed by PubChem (NCBI)