Products 250674-48-7

CAS 250674-48-7 appears in our catalog under these names: 2,7-Naphthyridine-3-carboxylic acid, 95%, 2,7-Naphthyridine-3-carboxylic acid, 97%, 2,7-naphthyridine-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,7-naphthyridine-3-carboxylic acid (CAS 250674-48-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 2,7-naphthyridine-3-carboxylic acid. InChIKey: REGNBBZZTQVCJU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O2
Molecular weight174.16 g/mol
IUPAC name2,7-naphthyridine-3-carboxylic acid
InChIKeyREGNBBZZTQVCJU-UHFFFAOYSA-N
SMILESC1=CN=CC2=CN=C(C=C21)C(=O)O

Computed by PubChem (NCBI)