Products 2514948-23-1
CAS 2514948-23-1 is the registry number for Methyl 3-(aminomethyl)-5-bromobenzoate hydrochloride, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-(aminomethyl)-5-bromobenzoate;hydrochloride (CAS 2514948-23-1) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 3-(aminomethyl)-5-bromobenzoate;hydrochloride. InChIKey: NAMWJVZIBJNQOK-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 3-(aminomethyl)-5-bromobenzoate;hydrochloride |
| InChIKey | NAMWJVZIBJNQOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)CN)Br.Cl |
Computed by PubChem (NCBI)