Products 253268-24-5

CAS 253268-24-5 is the registry number for Methyl 2,4-dichloro-5-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,4-dichloro-5-methoxybenzoate (CAS 253268-24-5) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 2,4-dichloro-5-methoxybenzoate. InChIKey: INFCQHUEUYVUOD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O3
Molecular weight235.06 g/mol
IUPAC namemethyl 2,4-dichloro-5-methoxybenzoate
InChIKeyINFCQHUEUYVUOD-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)OC)Cl)Cl

Computed by PubChem (NCBI)