CAS 25688-26-0 is the registry number for 1-(3-Nitrophenyl)-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-(3-nitrophenyl)indole (CAS 25688-26-0) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 1-(3-nitrophenyl)indole. InChIKey: VPKSVAIIPJLVJR-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1-(3-nitrophenyl)indole |
| InChIKey | VPKSVAIIPJLVJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)