CAS 25952-74-3 is the registry number for 3,5-Dibromo-4-hydroxybenzaldehyde oxime, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenol (CAS 25952-74-3) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenol. InChIKey: UVKQTDFYDUQTKK-XCVCLJGOSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenol |
| InChIKey | UVKQTDFYDUQTKK-XCVCLJGOSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)/C=N/O |
Computed by PubChem (NCBI)