Products 26118-14-9
CAS 26118-14-9 appears in our catalog under these names: 2-(2-Chlorophenyl)-2-oxoacetic acid, 95%, 2-(2-Chlorophenyl)-2-oxoacetic acid, 98%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2-chlorophenyl)-2-oxoacetic acid (CAS 26118-14-9) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-oxoacetic acid. InChIKey: OLRUAXAXQYMKFH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-oxoacetic acid |
| InChIKey | OLRUAXAXQYMKFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-phenyl-oxo-acetic acid, 2-(2-chlorophenyl)-2-oxoacetic acid, 2-Chlorophenyl-oxoacetic acid, Benzeneacetic acid, 2-chloro-alpha-oxo-, (2-chlorophenyl)(oxo)acetic acid, 2-Chlorobenzoylformic acid, 2-(2-chlorophenyl)-2-oxo-acetic Acid, 2-Chloro-.alpha.-oxo-benzeneacetic acid, o-chlorobenzoylformic acid, 8-butoxybenzene-sulfonylchloride