CAS 261909-66-4 is the registry number for 3,3-Dimethylbutyl L-alaninate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethylbutyl (2S)-2-aminopropanoate;hydrochloride (CAS 261909-66-4) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: 3,3-dimethylbutyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: NMJPGRGSOWQWMO-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | 3,3-dimethylbutyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | NMJPGRGSOWQWMO-FJXQXJEOSA-N |
| SMILES | C[C@@H](C(=O)OCCC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)