CAS 2624417-87-2 is the registry number for 5-bromo-2,3-difluoro-4-methylbenzonitrile, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-bromo-2,3-difluoro-4-methylbenzonitrile (CAS 2624417-87-2) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-methylbenzonitrile. InChIKey: BFOZHCWHULOAQK-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-methylbenzonitrile |
| InChIKey | BFOZHCWHULOAQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C#N)Br |
Computed by PubChem (NCBI)