Products 264272-63-1
CAS 264272-63-1 appears in our catalog under these names: 3-Bromo-4-(methoxycarbonyl)benzoic acid, 3-Bromo-4-(methoxycarbonyl)benzoic acid, 97%, 3-Bromo-4-(methoxycarbonyl)benzoic acid, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 100mg, 500mg, 2.5g.
3-bromo-4-methoxycarbonylbenzoic acid (CAS 264272-63-1) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 3-bromo-4-methoxycarbonylbenzoic acid. InChIKey: ZJGOZXACDNCTSA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 3-bromo-4-methoxycarbonylbenzoic acid |
| InChIKey | ZJGOZXACDNCTSA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)