Products 2648946-37-4
CAS 2648946-37-4 is the registry number for Methyl 4-(aminomethyl)-3-bromobenzoate hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl 4-(aminomethyl)-3-bromobenzoate;hydrochloride (CAS 2648946-37-4) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 4-(aminomethyl)-3-bromobenzoate;hydrochloride. InChIKey: SMTANYAYRWCAQV-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 4-(aminomethyl)-3-bromobenzoate;hydrochloride |
| InChIKey | SMTANYAYRWCAQV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CN)Br.Cl |
Computed by PubChem (NCBI)