CAS 2688735-06-8 is the registry number for 5-Chloro-6-nitroisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-6-nitro-2,3-dihydro-1H-isoindole (CAS 2688735-06-8) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-6-nitro-2,3-dihydro-1H-isoindole. InChIKey: JIURPGDOMVXHNT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-6-nitro-2,3-dihydro-1H-isoindole |
| InChIKey | JIURPGDOMVXHNT-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2CN1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)