CAS 26962-50-5 is the registry number for 1-(2,4-Dihydroxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one, 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-1-(2,4-dihydroxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one (CAS 26962-50-5) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: (E)-1-(2,4-dihydroxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one. InChIKey: MACMAADVRVVHBD-VMPITWQZSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (E)-1-(2,4-dihydroxyphenyl)-3-(2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | MACMAADVRVVHBD-VMPITWQZSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)