CAS 270062-92-5 appears in our catalog under these names: (S)-3-Amino-4-(3-methylphenyl)butanoic acid hydrochloride, 95%, H-β-HoPhe(3-Me)-OH, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(3S)-3-amino-4-(3-methylphenyl)butanoic acid;hydrochloride (CAS 270062-92-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (3S)-3-amino-4-(3-methylphenyl)butanoic acid;hydrochloride. InChIKey: CQHTUCDBCBKMKL-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (3S)-3-amino-4-(3-methylphenyl)butanoic acid;hydrochloride |
| InChIKey | CQHTUCDBCBKMKL-PPHPATTJSA-N |
| SMILES | CC1=CC(=CC=C1)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)