CAS 331846-93-6 is the registry number for (S)–3–Amino–4–(m–tolyl)butanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
(3S)-3-amino-4-(3-methylphenyl)butanoic acid;hydrochloride (CAS 331846-93-6) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (3S)-3-amino-4-(3-methylphenyl)butanoic acid;hydrochloride. InChIKey: CQHTUCDBCBKMKL-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (3S)-3-amino-4-(3-methylphenyl)butanoic acid;hydrochloride |
| InChIKey | CQHTUCDBCBKMKL-PPHPATTJSA-N |
| SMILES | CC1=CC(=CC=C1)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)