CAS 270063-47-3 appears in our catalog under these names: (S)-3-Amino-4-(2,4-dichlorophenyl)butanoic acid hydrochloride, 95%, 3,4–Dichloro–Phe–OMe·HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100g, 25g, 5g.
(3S)-3-amino-4-(2,4-dichlorophenyl)butanoic acid;hydrochloride (CAS 270063-47-3) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: (3S)-3-amino-4-(2,4-dichlorophenyl)butanoic acid;hydrochloride. InChIKey: JNGZEMBEPQATGG-QRPNPIFTSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | (3S)-3-amino-4-(2,4-dichlorophenyl)butanoic acid;hydrochloride |
| InChIKey | JNGZEMBEPQATGG-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)