Products 173522-95-7
CAS 173522-95-7 appears in our catalog under these names: 3,4-Dichloro-phe-ome hydrochloride, 98%, H–Phe(3,4–DiCl)–OMe?HCl, 3,4-Dichloro-phe-ome HCl, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 250mg.
Methyl (2S)-2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride (CAS 173522-95-7) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride. InChIKey: NOTFEHXAVUQWDQ-FVGYRXGTSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | NOTFEHXAVUQWDQ-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Phe(3,4-DiCl)-OMe.HCl, 3,4-Dichloro-phe-ome HCl, 3,4-Dichloro-phe-OMe hydrochloride, 3,4-Dichloro-L-Phenylalanine Methyl ester, L-Phenylalanine, 3,4-dichloro-, methyl ester, hydrochloride (9CI), methyl (2S)-2-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride, 3,4-Dichloro-L-phenylalanine methyl ester hydrochloride, H-Phe(3,4-DiCl)-OMe HCl, NOTFEHXAVUQWDQ-FVGYRXGTSA-N, (S)-3,4-dichlorophenylalanine methyl ester hydrochloride