CAS 331847-13-3 appears in our catalog under these names: (R)-3-Amino-4-(2,4-dichloro-phenyl)-butyric acid hydrochloride, 95%, (R)–3–Amino–4–(2,4–dichlorophenyl)butanoic acid hydrochloride, (R)-3-Amino-4-(2,4-dichlorophenyl)butanoic acid hydrochloride, 97%, 97%, (R)-3-Amino-4-(2,4-dichlorophenyl)butanoic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-3-amino-4-(2,4-dichlorophenyl)butanoic acid;hydrochloride (CAS 331847-13-3) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: (3R)-3-amino-4-(2,4-dichlorophenyl)butanoic acid;hydrochloride. InChIKey: JNGZEMBEPQATGG-DDWIOCJRSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | (3R)-3-amino-4-(2,4-dichlorophenyl)butanoic acid;hydrochloride |
| InChIKey | JNGZEMBEPQATGG-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)