Products 1423040-66-7
CAS 1423040-66-7 appears in our catalog under these names: Methyl (3s)-3-amino-3-(3,5-dichlorophenyl)propanoate hydrochloride, 95%, Methyl(3S)-3-amino-3-(3,5-dichlorophenyl)propanoate hcl, 95%, Methyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
Methyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride (CAS 1423040-66-7) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: methyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride. InChIKey: IXGCQMRPAAXSKH-FVGYRXGTSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | IXGCQMRPAAXSKH-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)