CAS 269396-55-6 appears in our catalog under these names: (R)-3-Amino-4-(3,4-dichlorophenyl)butanoic acid hydrochloride, 95%, (R)-3-Amino-4-(3,4-dichlorophenyl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(3R)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride (CAS 269396-55-6) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: (3R)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride. InChIKey: RNDGKTAEVJUWKK-OGFXRTJISA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | (3R)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride |
| InChIKey | RNDGKTAEVJUWKK-OGFXRTJISA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](CC(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)