CAS 270063-50-8 appears in our catalog under these names: (S)-3-Amino-4-(3,4-dichlorophenyl)butanoic acid hydrochloride, 95%, H-β-HoPhe(3,4-DiCl)-OH, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(3S)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride (CAS 270063-50-8) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: (3S)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride. InChIKey: RNDGKTAEVJUWKK-FJXQXJEOSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | (3S)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride |
| InChIKey | RNDGKTAEVJUWKK-FJXQXJEOSA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](CC(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)