Products 2097958-02-4
CAS 2097958-02-4 appears in our catalog under these names: (R)-Methyl 3-amino-3-(3,4-dichlorophenyl)propanoate hydrochloride, 95%, (R)–Methyl 3–amino–3–(3，4–dichlorophenyl)propanoate hydrochloride, (R)-Methyl 3-amino-3-(3,4-dichlorophenyl)propanoate hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl (3R)-3-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride (CAS 2097958-02-4) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: methyl (3R)-3-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride. InChIKey: DJSSFGWNYRSXFO-SBSPUUFOSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | DJSSFGWNYRSXFO-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)