Products 2565792-38-1
CAS 2565792-38-1 is the registry number for Methyl (3s)-3-amino-3-(3,4-dichlorophenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
Methyl (3S)-3-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride (CAS 2565792-38-1) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: methyl (3S)-3-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride. InChIKey: DJSSFGWNYRSXFO-FVGYRXGTSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(3,4-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | DJSSFGWNYRSXFO-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)