CAS 2702323-46-2 is the registry number for ethyl rel-(1R,2S,4S)-4-amino-2-methyl-cyclohexanecarboxylate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl (1R,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate;hydrochloride (CAS 2702323-46-2) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: ethyl (1R,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate;hydrochloride. InChIKey: ZOJHYUXHPYWVPT-CTERPIQNSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | ethyl (1R,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate;hydrochloride |
| InChIKey | ZOJHYUXHPYWVPT-CTERPIQNSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H](C[C@@H]1C)N.Cl |
Computed by PubChem (NCBI)