CAS 2920186-91-8 is the registry number for Ethyl (1S,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Ethyl (1S,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate;hydrochloride (CAS 2920186-91-8) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: ethyl (1S,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate;hydrochloride. InChIKey: ZOJHYUXHPYWVPT-YWUTZLAHSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | ethyl (1S,2S,4S)-4-amino-2-methylcyclohexane-1-carboxylate;hydrochloride |
| InChIKey | ZOJHYUXHPYWVPT-YWUTZLAHSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](C[C@@H]1C)N.Cl |
Computed by PubChem (NCBI)