CAS 2702457-73-4 is the registry number for cis-3-ethoxytetrahydropyran-4-amine,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3S,4S)-3-ethoxyoxan-4-amine;hydrochloride (CAS 2702457-73-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3S,4S)-3-ethoxyoxan-4-amine;hydrochloride. InChIKey: XQYAVFOEPKQNSE-UOERWJHTSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (3S,4S)-3-ethoxyoxan-4-amine;hydrochloride |
| InChIKey | XQYAVFOEPKQNSE-UOERWJHTSA-N |
| SMILES | CCO[C@@H]1COCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)