Products 2703764-14-9
CAS 2703764-14-9 is the registry number for Desamino lenalidomide-4-COOH. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxylic acid (CAS 2703764-14-9) is a chemical compound with the molecular formula C14H12N2O5 and a molecular weight of 288.25 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxylic acid. InChIKey: HCSDOKZCSFSOOE-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-4-carboxylic acid |
| InChIKey | HCSDOKZCSFSOOE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)