Products 2710376-48-8
CAS 2710376-48-8 is the registry number for Antioxidant agent-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3,4-dihydroxyphenyl)ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate (CAS 2710376-48-8) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate. InChIKey: MHHYXSGOKSQPCV-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)ethyl 7,8-dihydroxy-2-oxochromene-3-carboxylate |
| InChIKey | MHHYXSGOKSQPCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCOC(=O)C2=CC3=C(C(=C(C=C3)O)O)OC2=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Antioxidant agent-3