CAS 27111-45-1 appears in our catalog under these names: Ethyl 4-(carbonochloridoyl)benzoate, 95%, Ethyl 4-(carbonochloridoyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 4-carbonochloridoylbenzoate (CAS 27111-45-1) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: ethyl 4-carbonochloridoylbenzoate. InChIKey: POYHUEAWYYJRQL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | ethyl 4-carbonochloridoylbenzoate |
| InChIKey | POYHUEAWYYJRQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)