Products 2734777-42-3
CAS 2734777-42-3 is the registry number for 2,3-Difluoro-4-(methoxymethoxy)benzoic acid, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,3-difluoro-4-(methoxymethoxy)benzoic acid (CAS 2734777-42-3) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2,3-difluoro-4-(methoxymethoxy)benzoic acid. InChIKey: YOIJVUMWFWICAX-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2,3-difluoro-4-(methoxymethoxy)benzoic acid |
| InChIKey | YOIJVUMWFWICAX-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)C(=O)O)F)F |
Computed by PubChem (NCBI)