Products 2735735-23-4
CAS 2735735-23-4 is the registry number for Dibutepinephrine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(1R)-1-hydroxy-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate (CAS 2735735-23-4) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: [4-[(1R)-1-hydroxy-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate. InChIKey: XUROVJXCRSDXKR-ZDUSSCGKSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | [4-[(1R)-1-hydroxy-2-(methylamino)ethyl]-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate |
| InChIKey | XUROVJXCRSDXKR-ZDUSSCGKSA-N |
| SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)[C@H](CNC)O)OC(=O)C(C)C |
Computed by PubChem (NCBI)