CAS 27363-39-9 is the registry number for 2H-1,2-Benzothiazin-3(4H)-one, 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-4H-1lambda6,2-benzothiazin-3-one (CAS 27363-39-9) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 1,1-dioxo-4H-1lambda6,2-benzothiazin-3-one. InChIKey: JBWSEIGJTHGZRV-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 1,1-dioxo-4H-1lambda6,2-benzothiazin-3-one |
| InChIKey | JBWSEIGJTHGZRV-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2S(=O)(=O)NC1=O |
Computed by PubChem (NCBI)