Products 2742623-89-6
CAS 2742623-89-6 is the registry number for methyl (2S)-2-amino-3-{bicyclo[1.1.1]pentan-1-yl}propanoate hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl (2S)-2-amino-3-(1-bicyclo[1.1.1]pentanyl)propanoate;hydrochloride (CAS 2742623-89-6) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1-bicyclo[1.1.1]pentanyl)propanoate;hydrochloride. InChIKey: QIFNZYPMNJVECS-VEASCYRISA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1-bicyclo[1.1.1]pentanyl)propanoate;hydrochloride |
| InChIKey | QIFNZYPMNJVECS-VEASCYRISA-N |
| SMILES | COC(=O)[C@H](CC12CC(C1)C2)N.Cl |
Computed by PubChem (NCBI)