Products 2755724-30-0
CAS 2755724-30-0 is the registry number for 5-Chloro-2,6-dimethoxypyridine-3-carboxylic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-chloro-2,6-dimethoxypyridine-3-carboxylic acid (CAS 2755724-30-0) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: 5-chloro-2,6-dimethoxypyridine-3-carboxylic acid. InChIKey: OTNGIFABAUQWDT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 5-chloro-2,6-dimethoxypyridine-3-carboxylic acid |
| InChIKey | OTNGIFABAUQWDT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C(=O)O)Cl |
Computed by PubChem (NCBI)