CAS 27691-14-1 is the registry number for 1,2-Bis(difluoromethoxy)benzene, 95+%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
1,2-bis(difluoromethoxy)benzene (CAS 27691-14-1) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: 1,2-bis(difluoromethoxy)benzene. InChIKey: ITQCXTOQWOFOGH-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | 1,2-bis(difluoromethoxy)benzene |
| InChIKey | ITQCXTOQWOFOGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC(F)F)OC(F)F |
Computed by PubChem (NCBI)