CAS 27955-58-4 is the registry number for 2-Phenylimidazo(1,2-a)pyrazin-3(7H)-one. Offered by: Biosynth. Available pack sizes: 2mg, 5mg, 10mg, 25mg.
2-phenylimidazo[1,2-a]pyrazin-3-ol (CAS 27955-58-4) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 2-phenylimidazo[1,2-a]pyrazin-3-ol. InChIKey: JKXUCFWIJZSEIS-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-phenylimidazo[1,2-a]pyrazin-3-ol |
| InChIKey | JKXUCFWIJZSEIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C=CN=CC3=N2)O |
Computed by PubChem (NCBI)